About [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol
[1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol (PubChem CID 102782269) has the molecular formula C12H17N3O2S
and a molecular weight of 267.35 g/mol. Its IUPAC name is [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol |
| PubChem CID | 102782269 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol |
| SMILES | CC1CCN(c2nc3sccn3c2CO)C1CO |
| InChI | InChI=1S/C12H17N3O2S/c1-8-2-3-14(9(8)6-16)11-10(7-17)15-4-5-18-12(15)13-11/h4-5,8-9,16-17H,2-3,6-7H2,1H3 |
| InChIKey | MTVWAMBLYCUGIZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol?
The IUPAC name of [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol (CID 102782269) is [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol.
What is the SMILES notation for [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol?
The canonical SMILES for [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol is CC1CCN(c2nc3sccn3c2CO)C1CO.
What is the InChIKey of [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol?
The InChIKey is MTVWAMBLYCUGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2S/c1-8-2-3-14(9(8)6-16)11-10(7-17)15-4-5-18-12(15)13-11/h4-5,8-9,16-17H,2-3,6-7H2,1H3.
What are the key properties of [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol?
[1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol has a molecular weight of 267.35 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[5-(hydroxymethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpyrrolidin-2-yl]methanol is sourced from PubChem (CID 102782269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).