C19H19IN4O2S — CID 10278292
3-iodo-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]indazole (PubChem CID 10278292) has the molecular formula C19H19IN4O2S and a molecular weight of 494.36 g/mol. Its IUPAC name is 3-iodo-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]indazole.
| Compound Name | 3-iodo-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]indazole |
|---|---|
| PubChem CID | 10278292 |
| Molecular Formula | C19H19IN4O2S |
| Molecular Weight | 494.36 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | 3-iodo-1-[[1-(3-methylsulfonylpropyl)benzimidazol-2-yl]methyl]indazole |
| SMILES | CS(=O)(=O)CCCn1c(Cn2nc(I)c3ccccc32)nc2ccccc21 |
| InChI | InChI=1S/C19H19IN4O2S/c1-27(25,26)12-6-11-23-17-10-5-3-8-15(17)21-18(23)13-24-16-9-4-2-7-14(16)19(20)22-24/h2-5,7-10H,6,11-13H2,1H3 |
| InChIKey | UPZYLTWGBGUCBA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.36 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|