C9H19N3O4S — CID 102783716
ethyl N-[2-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylcarbamate (PubChem CID 102783716) has the molecular formula C9H19N3O4S and a molecular weight of 265.33 g/mol. Its IUPAC name is ethyl N-[2-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylcarbamate.
| Compound Name | ethyl N-[2-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 102783716 |
| Molecular Formula | C9H19N3O4S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | ethyl N-[2-(aminomethyl)-3-methylpyrrolidin-1-yl]sulfonylcarbamate |
| SMILES | CCOC(=O)NS(=O)(=O)N1CCC(C)C1CN |
| InChI | InChI=1S/C9H19N3O4S/c1-3-16-9(13)11-17(14,15)12-5-4-7(2)8(12)6-10/h7-8H,3-6,10H2,1-2H3,(H,11,13) |
| InChIKey | DXROBQKOYFWUPI-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |