C13H17BrClN — CID 102784977
1-[(3-bromophenyl)methyl]-2-(chloromethyl)-3-methylpyrrolidine (PubChem CID 102784977) has the molecular formula C13H17BrClN and a molecular weight of 302.64 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-2-(chloromethyl)-3-methylpyrrolidine.
| Compound Name | 1-[(3-bromophenyl)methyl]-2-(chloromethyl)-3-methylpyrrolidine |
|---|---|
| PubChem CID | 102784977 |
| Molecular Formula | C13H17BrClN |
| Molecular Weight | 302.64 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-2-(chloromethyl)-3-methylpyrrolidine |
| SMILES | CC1CCN(Cc2cccc(Br)c2)C1CCl |
| InChI | InChI=1S/C13H17BrClN/c1-10-5-6-16(13(10)8-15)9-11-3-2-4-12(14)7-11/h2-4,7,10,13H,5-6,8-9H2,1H3 |
| InChIKey | QJRYSUISAYDYFL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|