C12H15BrClN — CID 63388042
1-[(3-bromophenyl)methyl]-2-(chloromethyl)pyrrolidine (PubChem CID 63388042) has the molecular formula C12H15BrClN and a molecular weight of 288.62 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-2-(chloromethyl)pyrrolidine.
| Compound Name | 1-[(3-bromophenyl)methyl]-2-(chloromethyl)pyrrolidine |
|---|---|
| PubChem CID | 63388042 |
| Molecular Formula | C12H15BrClN |
| Molecular Weight | 288.62 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-2-(chloromethyl)pyrrolidine |
| SMILES | ClCC1CCCN1Cc1cccc(Br)c1 |
| InChI | InChI=1S/C12H15BrClN/c13-11-4-1-3-10(7-11)9-15-6-2-5-12(15)8-14/h1,3-4,7,12H,2,5-6,8-9H2 |
| InChIKey | WLYFUMCTLWNKIL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.62 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|