C14H20N4O3 — CID 102785922
1-[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-3-methylpyrrolidine-2-carboxylic acid (PubChem CID 102785922) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-3-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-3-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102785922 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[2-[bis(2-cyanoethyl)amino]-2-oxoethyl]-3-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC1CCN(CC(=O)N(CCC#N)CCC#N)C1C(=O)O |
| InChI | InChI=1S/C14H20N4O3/c1-11-4-9-18(13(11)14(20)21)10-12(19)17(7-2-5-15)8-3-6-16/h11,13H,2-4,7-10H2,1H3,(H,20,21) |
| InChIKey | CLVFJQWLAHQXKZ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 108.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |