C10H15NO2 — CID 102785800
1-but-2-ynyl-3-methylpyrrolidine-2-carboxylic acid (PubChem CID 102785800) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 1-but-2-ynyl-3-methylpyrrolidine-2-carboxylic acid.
| Compound Name | 1-but-2-ynyl-3-methylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 102785800 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 1-but-2-ynyl-3-methylpyrrolidine-2-carboxylic acid |
| SMILES | CC#CCN1CCC(C)C1C(=O)O |
| InChI | InChI=1S/C10H15NO2/c1-3-4-6-11-7-5-8(2)9(11)10(12)13/h8-9H,5-7H2,1-2H3,(H,12,13) |
| InChIKey | ZLXPXCANNXHGPY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|