C11H21NO3 — CID 106454831
3-methyl-1-(2-propoxyethyl)pyrrolidine-2-carboxylic acid (PubChem CID 106454831) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is 3-methyl-1-(2-propoxyethyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 3-methyl-1-(2-propoxyethyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 106454831 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 3-methyl-1-(2-propoxyethyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCOCCN1CCC(C)C1C(=O)O |
| InChI | InChI=1S/C11H21NO3/c1-3-7-15-8-6-12-5-4-9(2)10(12)11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | XHIULTQZPJMZRX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|