C12H18BrN3 — CID 102786337
5-[2-(bromomethyl)-3-methylpyrrolidin-1-yl]-2,3-dimethylpyrazine (PubChem CID 102786337) has the molecular formula C12H18BrN3 and a molecular weight of 284.20 g/mol. Its IUPAC name is 5-[2-(bromomethyl)-3-methylpyrrolidin-1-yl]-2,3-dimethylpyrazine.
| Compound Name | 5-[2-(bromomethyl)-3-methylpyrrolidin-1-yl]-2,3-dimethylpyrazine |
|---|---|
| PubChem CID | 102786337 |
| Molecular Formula | C12H18BrN3 |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 5-[2-(bromomethyl)-3-methylpyrrolidin-1-yl]-2,3-dimethylpyrazine |
| SMILES | Cc1ncc(N2CCC(C)C2CBr)nc1C |
| InChI | InChI=1S/C12H18BrN3/c1-8-4-5-16(11(8)6-13)12-7-14-9(2)10(3)15-12/h7-8,11H,4-6H2,1-3H3 |
| InChIKey | WIQSLAPUGXMDSG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|