C10H15N3O — CID 104929635
(3R)-1-(5,6-dimethylpyrazin-2-yl)pyrrolidin-3-ol (PubChem CID 104929635) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is (3R)-1-(5,6-dimethylpyrazin-2-yl)pyrrolidin-3-ol.
| Compound Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 104929635 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)pyrrolidin-3-ol |
| SMILES | Cc1ncc(N2CC[C@@H](O)C2)nc1C |
| InChI | InChI=1S/C10H15N3O/c1-7-8(2)12-10(5-11-7)13-4-3-9(14)6-13/h5,9,14H,3-4,6H2,1-2H3/t9-/m1/s1 |
| InChIKey | KNCULNLWXCAJIT-SECBINFHSA-N |
| XLogP | 0.66 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |