C11H18N4 — CID 102986367
(3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine (PubChem CID 102986367) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine.
| Compound Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 102986367 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine |
| SMILES | Cc1ncc(N2CCC[C@@H](N)C2)nc1C |
| InChI | InChI=1S/C11H18N4/c1-8-9(2)14-11(6-13-8)15-5-3-4-10(12)7-15/h6,10H,3-5,7,12H2,1-2H3/t10-/m1/s1 |
| InChIKey | IZUBUVUBQZDZNA-SNVBAGLBSA-N |
| XLogP | 1.02 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |