About (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine
(3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine (PubChem CID 102986367) has the molecular formula C11H18N4
and a molecular weight of 206.29 g/mol. Its IUPAC name is (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine.
Molecular Properties
| Compound Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine |
| PubChem CID | 102986367 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine |
| SMILES | Cc1ncc(N2CCC[C@@H](N)C2)nc1C |
| InChI | InChI=1S/C11H18N4/c1-8-9(2)14-11(6-13-8)15-5-3-4-10(12)7-15/h6,10H,3-5,7,12H2,1-2H3/t10-/m1/s1 |
| InChIKey | IZUBUVUBQZDZNA-SNVBAGLBSA-N |
| XLogP | 1.02 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine?
The IUPAC name of (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine (CID 102986367) is (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine.
What is the SMILES notation for (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine?
The canonical SMILES for (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine is Cc1ncc(N2CCC[C@@H](N)C2)nc1C.
What is the InChIKey of (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine?
The InChIKey is IZUBUVUBQZDZNA-SNVBAGLBSA-N. The full InChI is InChI=1S/C11H18N4/c1-8-9(2)14-11(6-13-8)15-5-3-4-10(12)7-15/h6,10H,3-5,7,12H2,1-2H3/t10-/m1/s1.
What are the key properties of (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine?
(3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine has a molecular weight of 206.29 g/mol, XLogP of 1.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-(5,6-dimethylpyrazin-2-yl)piperidin-3-amine is sourced from PubChem (CID 102986367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).