C11H15N5 — CID 141448207
1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)piperidin-3-amine (PubChem CID 141448207) has the molecular formula C11H15N5 and a molecular weight of 217.28 g/mol. Its IUPAC name is 1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)piperidin-3-amine.
| Compound Name | 1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 141448207 |
| Molecular Formula | C11H15N5 |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(5H-pyrrolo[2,3-b]pyrazin-2-yl)piperidin-3-amine |
| SMILES | NC1CCCN(c2cnc3[nH]ccc3n2)C1 |
| InChI | InChI=1S/C11H15N5/c12-8-2-1-5-16(7-8)10-6-14-11-9(15-10)3-4-13-11/h3-4,6,8H,1-2,5,7,12H2,(H,13,14) |
| InChIKey | RDRWIKHSPLBWJR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |