C15H19N7 — CID 136631331
1-(11-ethyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine (PubChem CID 136631331) has the molecular formula C15H19N7 and a molecular weight of 297.37 g/mol. Its IUPAC name is 1-(11-ethyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine.
| Compound Name | 1-(11-ethyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 136631331 |
| Molecular Formula | C15H19N7 |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1-(11-ethyl-5,7,8,10,12-pentazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine |
| SMILES | CCc1nc(N2CCCC(N)C2)c2c(nnc3nccc32)[nH]1 |
| InChI | InChI=1S/C15H19N7/c1-2-11-18-14-12(10-5-6-17-13(10)20-21-14)15(19-11)22-7-3-4-9(16)8-22/h5-6,9H,2-4,7-8,16H2,1H3,(H,18,19,21) |
| InChIKey | JPZKVHUURKGJFG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |