C15H18N6 — CID 137211035
N-methyl-1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine (PubChem CID 137211035) has the molecular formula C15H18N6 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-methyl-1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine.
| Compound Name | N-methyl-1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 137211035 |
| Molecular Formula | C15H18N6 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-methyl-1-(5,7,10,12-tetrazatricyclo[7.4.0.02,6]trideca-1(13),2,4,6,8,11-hexaen-13-yl)piperidin-3-amine |
| SMILES | CNC1CCCN(c2nc[nH]c3cnc4nccc4c23)C1 |
| InChI | InChI=1S/C15H18N6/c1-16-10-3-2-6-21(8-10)15-13-11-4-5-17-14(11)18-7-12(13)19-9-20-15/h4-5,7,9-10,16H,2-3,6,8H2,1H3,(H,19,20) |
| InChIKey | WFWZYDKNPOMGQO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |