C13H18N4 — CID 151731068
N-methyl-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-amine (PubChem CID 151731068) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is N-methyl-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-amine.
| Compound Name | N-methyl-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 151731068 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | N-methyl-1-(1H-pyrrolo[2,3-b]pyridin-5-yl)piperidin-3-amine |
| SMILES | CNC1CCCN(c2cnc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C13H18N4/c1-14-11-3-2-6-17(9-11)12-7-10-4-5-15-13(10)16-8-12/h4-5,7-8,11,14H,2-3,6,9H2,1H3,(H,15,16) |
| InChIKey | RKOJQKGYBLNQMP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |