C14H17ClN4 — CID 97164747
(3R)-1-(3-chloroquinoxalin-2-yl)-N-methylpiperidin-3-amine (PubChem CID 97164747) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is (3R)-1-(3-chloroquinoxalin-2-yl)-N-methylpiperidin-3-amine.
| Compound Name | (3R)-1-(3-chloroquinoxalin-2-yl)-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 97164747 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | (3R)-1-(3-chloroquinoxalin-2-yl)-N-methylpiperidin-3-amine |
| SMILES | CN[C@@H]1CCCN(c2nc3ccccc3nc2Cl)C1 |
| InChI | InChI=1S/C14H17ClN4/c1-16-10-5-4-8-19(9-10)14-13(15)17-11-6-2-3-7-12(11)18-14/h2-3,6-7,10,16H,4-5,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | WKTMQIIAAKOFBN-SNVBAGLBSA-N |
| XLogP | 2.47 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |