C14H18N4O — CID 71648045
(3S)-1-[3-(methylamino)quinoxalin-2-yl]piperidin-3-ol (PubChem CID 71648045) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is (3S)-1-[3-(methylamino)quinoxalin-2-yl]piperidin-3-ol.
| Compound Name | (3S)-1-[3-(methylamino)quinoxalin-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 71648045 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (3S)-1-[3-(methylamino)quinoxalin-2-yl]piperidin-3-ol |
| SMILES | CNc1nc2ccccc2nc1N1CCC[C@H](O)C1 |
| InChI | InChI=1S/C14H18N4O/c1-15-13-14(18-8-4-5-10(19)9-18)17-12-7-3-2-6-11(12)16-13/h2-3,6-7,10,19H,4-5,8-9H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | WFPGVSGIXWLBCW-JTQLQIEISA-N |
| XLogP | 1.63 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |