C24H33ClN4 — CID 142337470
1-[4-(4-chlorophenyl)phthalazin-1-yl]-N-methylpiperidin-3-amine;ethane (PubChem CID 142337470) has the molecular formula C24H33ClN4 and a molecular weight of 413.01 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)phthalazin-1-yl]-N-methylpiperidin-3-amine;ethane.
| Compound Name | 1-[4-(4-chlorophenyl)phthalazin-1-yl]-N-methylpiperidin-3-amine;ethane |
|---|---|
| PubChem CID | 142337470 |
| Molecular Formula | C24H33ClN4 |
| Molecular Weight | 413.01 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 1-[4-(4-chlorophenyl)phthalazin-1-yl]-N-methylpiperidin-3-amine;ethane |
| SMILES | CC.CC.CNC1CCCN(c2nnc(-c3ccc(Cl)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C20H21ClN4.2C2H6/c1-22-16-5-4-12-25(13-16)20-18-7-3-2-6-17(18)19(23-24-20)14-8-10-15(21)11-9-14;2*1-2/h2-3,6-11,16,22H,4-5,12-13H2,1H3;2*1-2H3 |
| InChIKey | UUZDJKNKQUUQNG-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.01 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |