C21H22ClFN4 — CID 169230288
4-(4-chlorophenyl)-N-[1-(2-fluoroethyl)piperidin-3-yl]phthalazin-1-amine (PubChem CID 169230288) has the molecular formula C21H22ClFN4 and a molecular weight of 384.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[1-(2-fluoroethyl)piperidin-3-yl]phthalazin-1-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[1-(2-fluoroethyl)piperidin-3-yl]phthalazin-1-amine |
|---|---|
| PubChem CID | 169230288 |
| Molecular Formula | C21H22ClFN4 |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[1-(2-fluoroethyl)piperidin-3-yl]phthalazin-1-amine |
| SMILES | FCCN1CCCC(Nc2nnc(-c3ccc(Cl)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C21H22ClFN4/c22-16-9-7-15(8-10-16)20-18-5-1-2-6-19(18)21(26-25-20)24-17-4-3-12-27(14-17)13-11-23/h1-2,5-10,17H,3-4,11-14H2,(H,24,26) |
| InChIKey | BXWRWSVCOLJFOF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |