C21H21F3N4O — CID 170553920
N-[(3R)-1-methylpiperidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]phthalazin-1-amine (PubChem CID 170553920) has the molecular formula C21H21F3N4O and a molecular weight of 402.42 g/mol. Its IUPAC name is N-[(3R)-1-methylpiperidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]phthalazin-1-amine.
| Compound Name | N-[(3R)-1-methylpiperidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]phthalazin-1-amine |
|---|---|
| PubChem CID | 170553920 |
| Molecular Formula | C21H21F3N4O |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(3R)-1-methylpiperidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]phthalazin-1-amine |
| SMILES | CN1CCC[C@@H](Nc2nnc(-c3ccc(OC(F)(F)F)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C21H21F3N4O/c1-28-12-4-5-15(13-28)25-20-18-7-3-2-6-17(18)19(26-27-20)14-8-10-16(11-9-14)29-21(22,23)24/h2-3,6-11,15H,4-5,12-13H2,1H3,(H,25,27)/t15-/m1/s1 |
| InChIKey | PNYNXZACCQADDV-OAHLLOKOSA-N |
| XLogP | 4.70 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |