C22H23N5O — CID 166151237
3-methoxy-4-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]benzonitrile (PubChem CID 166151237) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-methoxy-4-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]benzonitrile.
| Compound Name | 3-methoxy-4-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 166151237 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 3-methoxy-4-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]benzonitrile |
| SMILES | COc1cc(C#N)ccc1-c1nnc(N[C@@H]2CCCN(C)C2)c2ccccc12 |
| InChI | InChI=1S/C22H23N5O/c1-27-11-5-6-16(14-27)24-22-18-8-4-3-7-17(18)21(25-26-22)19-10-9-15(13-23)12-20(19)28-2/h3-4,7-10,12,16H,5-6,11,14H2,1-2H3,(H,24,26)/t16-/m1/s1 |
| InChIKey | FEACVOOAWWSXMS-MRXNPFEDSA-N |
| XLogP | 3.68 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |