C27H34N4O2Si — CID 175599400
4-[2-(methoxymethoxy)-4-(2-trimethylsilylethynyl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine (PubChem CID 175599400) has the molecular formula C27H34N4O2Si and a molecular weight of 474.68 g/mol. Its IUPAC name is 4-[2-(methoxymethoxy)-4-(2-trimethylsilylethynyl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine.
| Compound Name | 4-[2-(methoxymethoxy)-4-(2-trimethylsilylethynyl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 175599400 |
| Molecular Formula | C27H34N4O2Si |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 4-[2-(methoxymethoxy)-4-(2-trimethylsilylethynyl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine |
| SMILES | COCOc1cc(C#C[Si](C)(C)C)ccc1-c1nnc(NC2CCCN(C)C2)c2ccccc12 |
| InChI | InChI=1S/C27H34N4O2Si/c1-31-15-8-9-21(18-31)28-27-23-11-7-6-10-22(23)26(29-30-27)24-13-12-20(14-16-34(3,4)5)17-25(24)33-19-32-2/h6-7,10-13,17,21H,8-9,15,18-19H2,1-5H3,(H,28,30) |
| InChIKey | WGFBONUFZISLIV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|