C25H26N4O — CID 170027495
2-[4-[[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]amino]phthalazin-1-yl]-5-ethynylphenol (PubChem CID 170027495) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[4-[[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]amino]phthalazin-1-yl]-5-ethynylphenol.
| Compound Name | 2-[4-[[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]amino]phthalazin-1-yl]-5-ethynylphenol |
|---|---|
| PubChem CID | 170027495 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[4-[[(3R)-1-(cyclopropylmethyl)piperidin-3-yl]amino]phthalazin-1-yl]-5-ethynylphenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(CC4CC4)C3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C25H26N4O/c1-2-17-11-12-22(23(30)14-17)24-20-7-3-4-8-21(20)25(28-27-24)26-19-6-5-13-29(16-19)15-18-9-10-18/h1,3-4,7-8,11-12,14,18-19,30H,5-6,9-10,13,15-16H2,(H,26,28)/t19-/m1/s1 |
| InChIKey | XYBCSPJOJIXUSD-LJQANCHMSA-N |
| XLogP | 4.27 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|