C24H27N5O2 — CID 176742603
5-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[2,3-d]pyridazin-8-amine (PubChem CID 176742603) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 5-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[2,3-d]pyridazin-8-amine.
| Compound Name | 5-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[2,3-d]pyridazin-8-amine |
|---|---|
| PubChem CID | 176742603 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 5-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyrido[2,3-d]pyridazin-8-amine |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(C)C3)c3ncccc23)c(OCOCC)c1 |
| InChI | InChI=1S/C24H27N5O2/c1-4-17-10-11-19(21(14-17)31-16-30-5-2)22-20-9-6-12-25-23(20)24(28-27-22)26-18-8-7-13-29(3)15-18/h1,6,9-12,14,18H,5,7-8,13,15-16H2,2-3H3,(H,26,28)/t18-/m1/s1 |
| InChIKey | GTHMALOXVMTKMU-GOSISDBHSA-N |
| XLogP | 3.55 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|