C24H30Br2N4O2 — CID 175435219
5-cyclopropyl-6-[4-(2,2-dibromoethenyl)-2-(ethoxymethoxy)phenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyridazin-3-amine (PubChem CID 175435219) has the molecular formula C24H30Br2N4O2 and a molecular weight of 566.34 g/mol. Its IUPAC name is 5-cyclopropyl-6-[4-(2,2-dibromoethenyl)-2-(ethoxymethoxy)phenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyridazin-3-amine.
| Compound Name | 5-cyclopropyl-6-[4-(2,2-dibromoethenyl)-2-(ethoxymethoxy)phenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyridazin-3-amine |
|---|---|
| PubChem CID | 175435219 |
| Molecular Formula | C24H30Br2N4O2 |
| Molecular Weight | 566.34 g/mol |
| Exact Mass | 564.07 |
| IUPAC Name | 5-cyclopropyl-6-[4-(2,2-dibromoethenyl)-2-(ethoxymethoxy)phenyl]-N-[(3R)-1-methylpiperidin-3-yl]pyridazin-3-amine |
| SMILES | CCOCOc1cc(C=C(Br)Br)ccc1-c1nnc(N[C@@H]2CCCN(C)C2)cc1C1CC1 |
| InChI | InChI=1S/C24H30Br2N4O2/c1-3-31-15-32-21-11-16(12-22(25)26)6-9-19(21)24-20(17-7-8-17)13-23(28-29-24)27-18-5-4-10-30(2)14-18/h6,9,11-13,17-18H,3-5,7-8,10,14-15H2,1-2H3,(H,27,28)/t18-/m1/s1 |
| InChIKey | MJTYFUQEEOTSBL-GOSISDBHSA-N |
| XLogP | 5.99 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.34 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|