C30H40N4O5 — CID 176652910
tert-butyl (3R)-3-[[4,5-dicyclopropyl-6-[2-(ethoxymethoxy)-4-formylphenyl]pyridazin-3-yl]amino]piperidine-1-carboxylate (PubChem CID 176652910) has the molecular formula C30H40N4O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is tert-butyl (3R)-3-[[4,5-dicyclopropyl-6-[2-(ethoxymethoxy)-4-formylphenyl]pyridazin-3-yl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[[4,5-dicyclopropyl-6-[2-(ethoxymethoxy)-4-formylphenyl]pyridazin-3-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 176652910 |
| Molecular Formula | C30H40N4O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | tert-butyl (3R)-3-[[4,5-dicyclopropyl-6-[2-(ethoxymethoxy)-4-formylphenyl]pyridazin-3-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOCOc1cc(C=O)ccc1-c1nnc(N[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)c(C2CC2)c1C1CC1 |
| InChI | InChI=1S/C30H40N4O5/c1-5-37-18-38-24-15-19(17-35)8-13-23(24)27-25(20-9-10-20)26(21-11-12-21)28(33-32-27)31-22-7-6-14-34(16-22)29(36)39-30(2,3)4/h8,13,15,17,20-22H,5-7,9-12,14,16,18H2,1-4H3,(H,31,33)/t22-/m1/s1 |
| InChIKey | SCDFPCLSZQGIMJ-JOCHJYFZSA-N |
| XLogP | 5.90 |
| TPSA | 102.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|