C23H30N4O3 — CID 168973382
2-[(3R)-3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethanol (PubChem CID 168973382) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-[(3R)-3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethanol.
| Compound Name | 2-[(3R)-3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethanol |
|---|---|
| PubChem CID | 168973382 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(3R)-3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethanol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(CCO)C3)cc2C)c(OCOCC)c1 |
| InChI | InChI=1S/C23H30N4O3/c1-4-18-8-9-20(21(14-18)30-16-29-5-2)23-17(3)13-22(25-26-23)24-19-7-6-10-27(15-19)11-12-28/h1,8-9,13-14,19,28H,5-7,10-12,15-16H2,2-3H3,(H,24,25)/t19-/m1/s1 |
| InChIKey | OYSJEXYSHRRPHA-LJQANCHMSA-N |
| XLogP | 2.67 |
| TPSA | 79.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|