C21H28N4O4 — CID 178140824
2-[2-[3-[[6-(2-hydroxy-4-methylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid (PubChem CID 178140824) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is 2-[2-[3-[[6-(2-hydroxy-4-methylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[3-[[6-(2-hydroxy-4-methylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 178140824 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | 2-[2-[3-[[6-(2-hydroxy-4-methylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid |
| SMILES | Cc1ccc(-c2nnc(NC3CCCN(CCOCC(=O)O)C3)cc2C)c(O)c1 |
| InChI | InChI=1S/C21H28N4O4/c1-14-5-6-17(18(26)10-14)21-15(2)11-19(23-24-21)22-16-4-3-7-25(12-16)8-9-29-13-20(27)28/h5-6,10-11,16,26H,3-4,7-9,12-13H2,1-2H3,(H,22,23)(H,27,28) |
| InChIKey | LZLYWYDAJOIMCF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|