C23H32N4O4 — CID 178140776
2-[2-[(3R)-3-[[6-(2-hydroxy-4-propan-2-ylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid (PubChem CID 178140776) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[2-[(3R)-3-[[6-(2-hydroxy-4-propan-2-ylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid.
| Compound Name | 2-[2-[(3R)-3-[[6-(2-hydroxy-4-propan-2-ylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid |
|---|---|
| PubChem CID | 178140776 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 2-[2-[(3R)-3-[[6-(2-hydroxy-4-propan-2-ylphenyl)-5-methylpyridazin-3-yl]amino]piperidin-1-yl]ethoxy]acetic acid |
| SMILES | Cc1cc(N[C@@H]2CCCN(CCOCC(=O)O)C2)nnc1-c1ccc(C(C)C)cc1O |
| InChI | InChI=1S/C23H32N4O4/c1-15(2)17-6-7-19(20(28)12-17)23-16(3)11-21(25-26-23)24-18-5-4-8-27(13-18)9-10-31-14-22(29)30/h6-7,11-12,15,18,28H,4-5,8-10,13-14H2,1-3H3,(H,24,25)(H,29,30)/t18-/m1/s1 |
| InChIKey | BYBAEAJKDMJWBF-GOSISDBHSA-N |
| XLogP | 3.26 |
| TPSA | 107.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|