C23H28N4O4 — CID 175435226
2-[3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]acetic acid (PubChem CID 175435226) has the molecular formula C23H28N4O4 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]acetic acid.
| Compound Name | 2-[3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 175435226 |
| Molecular Formula | C23H28N4O4 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 2-[3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methylpyridazin-3-yl]amino]piperidin-1-yl]acetic acid |
| SMILES | C#Cc1ccc(-c2nnc(NC3CCCN(CC(=O)O)C3)cc2C)c(OCOCC)c1 |
| InChI | InChI=1S/C23H28N4O4/c1-4-17-8-9-19(20(12-17)31-15-30-5-2)23-16(3)11-21(25-26-23)24-18-7-6-10-27(13-18)14-22(28)29/h1,8-9,11-12,18H,5-7,10,13-15H2,2-3H3,(H,24,25)(H,28,29) |
| InChIKey | ITMGCDPSUMDIPI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|