C23H29N5O2 — CID 171545191
5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-(trideuteriomethyl)piperidin-3-yl]-1,2,4-triazin-3-amine (PubChem CID 171545191) has the molecular formula C23H29N5O2 and a molecular weight of 410.54 g/mol. Its IUPAC name is 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-(trideuteriomethyl)piperidin-3-yl]-1,2,4-triazin-3-amine.
| Compound Name | 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-(trideuteriomethyl)piperidin-3-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 171545191 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N-[(3R)-1-(trideuteriomethyl)piperidin-3-yl]-1,2,4-triazin-3-amine |
| SMILES | [2H]C([2H])([2H])N1CCC[C@@H](Nc2nnc(-c3ccc(C#C)cc3OCOCC)c(C3CC3)n2)C1 |
| InChI | InChI=1S/C23H29N5O2/c1-4-16-8-11-19(20(13-16)30-15-29-5-2)22-21(17-9-10-17)25-23(27-26-22)24-18-7-6-12-28(3)14-18/h1,8,11,13,17-18H,5-7,9-10,12,14-15H2,2-3H3,(H,24,25,27)/t18-/m1/s1/i3D3 |
| InChIKey | SFAHYXZRBNBUDK-JXVMOJKPSA-N |
| XLogP | 3.28 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|