C18H21N5O — CID 168973458
5-ethynyl-2-[5-methyl-3-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-6-yl]phenol (PubChem CID 168973458) has the molecular formula C18H21N5O and a molecular weight of 323.40 g/mol. Its IUPAC name is 5-ethynyl-2-[5-methyl-3-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-ethynyl-2-[5-methyl-3-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 168973458 |
| Molecular Formula | C18H21N5O |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 5-ethynyl-2-[5-methyl-3-[[(3R)-1-methylpiperidin-3-yl]amino]-1,2,4-triazin-6-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(C)C3)nc2C)c(O)c1 |
| InChI | InChI=1S/C18H21N5O/c1-4-13-7-8-15(16(24)10-13)17-12(2)19-18(22-21-17)20-14-6-5-9-23(3)11-14/h1,7-8,10,14,24H,5-6,9,11H2,2-3H3,(H,19,20,22)/t14-/m1/s1 |
| InChIKey | BVZNLTKBNNCPPP-CQSZACIVSA-N |
| XLogP | 2.04 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|