C20H25N5O — CID 176742573
5-ethynyl-2-[3-[[(3R)-1-methylpiperidin-3-yl]amino]-5-propan-2-yl-1,2,4-triazin-6-yl]phenol (PubChem CID 176742573) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 5-ethynyl-2-[3-[[(3R)-1-methylpiperidin-3-yl]amino]-5-propan-2-yl-1,2,4-triazin-6-yl]phenol.
| Compound Name | 5-ethynyl-2-[3-[[(3R)-1-methylpiperidin-3-yl]amino]-5-propan-2-yl-1,2,4-triazin-6-yl]phenol |
|---|---|
| PubChem CID | 176742573 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 5-ethynyl-2-[3-[[(3R)-1-methylpiperidin-3-yl]amino]-5-propan-2-yl-1,2,4-triazin-6-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(C)C3)nc2C(C)C)c(O)c1 |
| InChI | InChI=1S/C20H25N5O/c1-5-14-8-9-16(17(26)11-14)19-18(13(2)3)22-20(24-23-19)21-15-7-6-10-25(4)12-15/h1,8-9,11,13,15,26H,6-7,10,12H2,2-4H3,(H,21,22,24)/t15-/m1/s1 |
| InChIKey | FARPBZCBDDOIOF-OAHLLOKOSA-N |
| XLogP | 2.86 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|