C22H22N4O3S — CID 176742616
5-ethynyl-2-[4-[[(3R)-1-methylsulfonylpiperidin-3-yl]amino]phthalazin-1-yl]phenol (PubChem CID 176742616) has the molecular formula C22H22N4O3S and a molecular weight of 422.51 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[[(3R)-1-methylsulfonylpiperidin-3-yl]amino]phthalazin-1-yl]phenol.
| Compound Name | 5-ethynyl-2-[4-[[(3R)-1-methylsulfonylpiperidin-3-yl]amino]phthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 176742616 |
| Molecular Formula | C22H22N4O3S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-ethynyl-2-[4-[[(3R)-1-methylsulfonylpiperidin-3-yl]amino]phthalazin-1-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(N[C@@H]3CCCN(S(C)(=O)=O)C3)c3ccccc23)c(O)c1 |
| InChI | InChI=1S/C22H22N4O3S/c1-3-15-10-11-19(20(27)13-15)21-17-8-4-5-9-18(17)22(25-24-21)23-16-7-6-12-26(14-16)30(2,28)29/h1,4-5,8-11,13,16,27H,6-7,12,14H2,2H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | QFSWOOCVXCOCRP-MRXNPFEDSA-N |
| XLogP | 2.82 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|