C22H26N4O3S — CID 175368051
5-methyl-2-[4-[(1-methylpiperidin-3-yl)amino]-6-methylsulfonylphthalazin-1-yl]phenol (PubChem CID 175368051) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 5-methyl-2-[4-[(1-methylpiperidin-3-yl)amino]-6-methylsulfonylphthalazin-1-yl]phenol.
| Compound Name | 5-methyl-2-[4-[(1-methylpiperidin-3-yl)amino]-6-methylsulfonylphthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 175368051 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 5-methyl-2-[4-[(1-methylpiperidin-3-yl)amino]-6-methylsulfonylphthalazin-1-yl]phenol |
| SMILES | Cc1ccc(-c2nnc(NC3CCCN(C)C3)c3cc(S(C)(=O)=O)ccc23)c(O)c1 |
| InChI | InChI=1S/C22H26N4O3S/c1-14-6-8-18(20(27)11-14)21-17-9-7-16(30(3,28)29)12-19(17)22(25-24-21)23-15-5-4-10-26(2)13-15/h6-9,11-12,15,27H,4-5,10,13H2,1-3H3,(H,23,25) |
| InChIKey | IQQLNURHXZMVMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |