C23H28N4O3S — CID 177308718
2-[4-[[(3S)-1-ethylpiperidin-3-yl]amino]-7-methylphthalazin-1-yl]-5-methylsulfonylphenol (PubChem CID 177308718) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-[4-[[(3S)-1-ethylpiperidin-3-yl]amino]-7-methylphthalazin-1-yl]-5-methylsulfonylphenol.
| Compound Name | 2-[4-[[(3S)-1-ethylpiperidin-3-yl]amino]-7-methylphthalazin-1-yl]-5-methylsulfonylphenol |
|---|---|
| PubChem CID | 177308718 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-[4-[[(3S)-1-ethylpiperidin-3-yl]amino]-7-methylphthalazin-1-yl]-5-methylsulfonylphenol |
| SMILES | CCN1CCC[C@H](Nc2nnc(-c3ccc(S(C)(=O)=O)cc3O)c3cc(C)ccc23)C1 |
| InChI | InChI=1S/C23H28N4O3S/c1-4-27-11-5-6-16(14-27)24-23-18-9-7-15(2)12-20(18)22(25-26-23)19-10-8-17(13-21(19)28)31(3,29)30/h7-10,12-13,16,28H,4-6,11,14H2,1-3H3,(H,24,26)/t16-/m0/s1 |
| InChIKey | YINLIYFQTSTOOZ-INIZCTEOSA-N |
| XLogP | 3.61 |
| TPSA | 95.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |