C20H24N4O3 — CID 168973515
3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methyl-1,2,4-triazin-3-yl]amino]-1-methylcyclobutan-1-ol (PubChem CID 168973515) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methyl-1,2,4-triazin-3-yl]amino]-1-methylcyclobutan-1-ol.
| Compound Name | 3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methyl-1,2,4-triazin-3-yl]amino]-1-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 168973515 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[[6-[2-(ethoxymethoxy)-4-ethynylphenyl]-5-methyl-1,2,4-triazin-3-yl]amino]-1-methylcyclobutan-1-ol |
| SMILES | C#Cc1ccc(-c2nnc(NC3CC(C)(O)C3)nc2C)c(OCOCC)c1 |
| InChI | InChI=1S/C20H24N4O3/c1-5-14-7-8-16(17(9-14)27-12-26-6-2)18-13(3)21-19(24-23-18)22-15-10-20(4,25)11-15/h1,7-9,15,25H,6,10-12H2,2-4H3,(H,21,22,24) |
| InChIKey | FRSUFNPKAMUYAP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|