C16H18N4O2 — CID 175923302
6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N,N-dimethyl-1,2,4-triazin-5-amine (PubChem CID 175923302) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is 6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N,N-dimethyl-1,2,4-triazin-5-amine.
| Compound Name | 6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N,N-dimethyl-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 175923302 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 6-[2-(ethoxymethoxy)-4-ethynylphenyl]-N,N-dimethyl-1,2,4-triazin-5-amine |
| SMILES | C#Cc1ccc(-c2nncnc2N(C)C)c(OCOCC)c1 |
| InChI | InChI=1S/C16H18N4O2/c1-5-12-7-8-13(14(9-12)22-11-21-6-2)15-16(20(3)4)17-10-18-19-15/h1,7-10H,6,11H2,2-4H3 |
| InChIKey | ZZNKZSMYEXJKDB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|