C24H32N4O2 — CID 171545171
5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-1-[(3R)-1-ethylpiperidin-3-yl]-2H-1,2,4-triazine (PubChem CID 171545171) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-1-[(3R)-1-ethylpiperidin-3-yl]-2H-1,2,4-triazine.
| Compound Name | 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-1-[(3R)-1-ethylpiperidin-3-yl]-2H-1,2,4-triazine |
|---|---|
| PubChem CID | 171545171 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 5-cyclopropyl-6-[2-(ethoxymethoxy)-4-ethynylphenyl]-1-[(3R)-1-ethylpiperidin-3-yl]-2H-1,2,4-triazine |
| SMILES | C#Cc1ccc(C2=C(C3CC3)N=CNN2[C@@H]2CCCN(CC)C2)c(OCOCC)c1 |
| InChI | InChI=1S/C24H32N4O2/c1-4-18-9-12-21(22(14-18)30-17-29-6-3)24-23(19-10-11-19)25-16-26-28(24)20-8-7-13-27(5-2)15-20/h1,9,12,14,16,19-20H,5-8,10-11,13,15,17H2,2-3H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | SMXSKJVWTZMDCD-HXUWFJFHSA-N |
| XLogP | 3.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|