C11H18ClN3O4S — CID 67924787
4-chloro-3-(1-ethylpiperidin-3-yl)-2H-thiadiazole;oxalic acid (PubChem CID 67924787) has the molecular formula C11H18ClN3O4S and a molecular weight of 323.80 g/mol. Its IUPAC name is 4-chloro-3-(1-ethylpiperidin-3-yl)-2H-thiadiazole;oxalic acid.
| Compound Name | 4-chloro-3-(1-ethylpiperidin-3-yl)-2H-thiadiazole;oxalic acid |
|---|---|
| PubChem CID | 67924787 |
| Molecular Formula | C11H18ClN3O4S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 4-chloro-3-(1-ethylpiperidin-3-yl)-2H-thiadiazole;oxalic acid |
| SMILES | CCN1CCCC(N2NSC=C2Cl)C1.O=C(O)C(=O)O |
| InChI | InChI=1S/C9H16ClN3S.C2H2O4/c1-2-12-5-3-4-8(6-12)13-9(10)7-14-11-13;3-1(4)2(5)6/h7-8,11H,2-6H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PAXZPAPVMBQRPN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|