C21H23N3O2 — CID 175435248
5-ethynyl-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol (PubChem CID 175435248) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 5-ethynyl-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol.
| Compound Name | 5-ethynyl-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 175435248 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 5-ethynyl-2-[4-[(3-hydroxy-3-methylcyclobutyl)amino]-5,6,7,8-tetrahydrophthalazin-1-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(NC3CC(C)(O)C3)c3c2CCCC3)c(O)c1 |
| InChI | InChI=1S/C21H23N3O2/c1-3-13-8-9-17(18(25)10-13)19-15-6-4-5-7-16(15)20(24-23-19)22-14-11-21(2,26)12-14/h1,8-10,14,25-26H,4-7,11-12H2,2H3,(H,22,24) |
| InChIKey | WSDXLAONMXSVSK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|