C22H20FN3O2 — CID 170027194
5-ethynyl-2-[6-fluoro-4-[(3-methoxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol (PubChem CID 170027194) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is 5-ethynyl-2-[6-fluoro-4-[(3-methoxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol.
| Compound Name | 5-ethynyl-2-[6-fluoro-4-[(3-methoxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol |
|---|---|
| PubChem CID | 170027194 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 5-ethynyl-2-[6-fluoro-4-[(3-methoxy-3-methylcyclobutyl)amino]phthalazin-1-yl]phenol |
| SMILES | C#Cc1ccc(-c2nnc(NC3CC(C)(OC)C3)c3cc(F)ccc23)c(O)c1 |
| InChI | InChI=1S/C22H20FN3O2/c1-4-13-5-7-17(19(27)9-13)20-16-8-6-14(23)10-18(16)21(26-25-20)24-15-11-22(2,12-15)28-3/h1,5-10,15,27H,11-12H2,2-3H3,(H,24,26) |
| InChIKey | DVKHAGQOIDVGOB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|