C22H18N4O2 — CID 176742590
1-(4-ethynyl-2-hydroxyphenyl)-4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazine-6-carbonitrile (PubChem CID 176742590) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-(4-ethynyl-2-hydroxyphenyl)-4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazine-6-carbonitrile.
| Compound Name | 1-(4-ethynyl-2-hydroxyphenyl)-4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazine-6-carbonitrile |
|---|---|
| PubChem CID | 176742590 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-(4-ethynyl-2-hydroxyphenyl)-4-[(3-hydroxy-3-methylcyclobutyl)amino]phthalazine-6-carbonitrile |
| SMILES | C#Cc1ccc(-c2nnc(NC3CC(C)(O)C3)c3cc(C#N)ccc23)c(O)c1 |
| InChI | InChI=1S/C22H18N4O2/c1-3-13-4-7-17(19(27)9-13)20-16-6-5-14(12-23)8-18(16)21(26-25-20)24-15-10-22(2,28)11-15/h1,4-9,15,27-28H,10-11H2,2H3,(H,24,26) |
| InChIKey | KMQFGSGGTJKQSL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 102.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|