About 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile
4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile (PubChem CID 175368116) has the molecular formula C21H19F2N5O
and a molecular weight of 395.41 g/mol. Its IUPAC name is 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile.
Molecular Properties
| Compound Name | 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile |
| PubChem CID | 175368116 |
| Molecular Formula | C21H19F2N5O |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile |
| SMILES | CN1CC(Nc2nnc(-c3ccc(C#N)cc3O)c3ccccc23)CC(F)(F)C1 |
| InChI | InChI=1S/C21H19F2N5O/c1-28-11-14(9-21(22,23)12-28)25-20-16-5-3-2-4-15(16)19(26-27-20)17-7-6-13(10-24)8-18(17)29/h2-8,14,29H,9,11-12H2,1H3,(H,25,27) |
| InChIKey | ZGCPVHNFWJFRCJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile?
The IUPAC name of 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile (CID 175368116) is 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile.
What is the SMILES notation for 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile?
The canonical SMILES for 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile is CN1CC(Nc2nnc(-c3ccc(C#N)cc3O)c3ccccc23)CC(F)(F)C1.
What is the InChIKey of 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile?
The InChIKey is ZGCPVHNFWJFRCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N5O/c1-28-11-14(9-21(22,23)12-28)25-20-16-5-3-2-4-15(16)19(26-27-20)17-7-6-13(10-24)8-18(17)29/h2-8,14,29H,9,11-12H2,1H3,(H,25,27).
What are the key properties of 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile?
4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile has a molecular weight of 395.41 g/mol, XLogP of 3.63, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(5,5-difluoro-1-methylpiperidin-3-yl)amino]phthalazin-1-yl]-3-hydroxybenzonitrile is sourced from PubChem (CID 175368116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).