C25H29N5O3 — CID 175368263
3-(ethoxymethoxy)-4-[4-[[1-(2-hydroxyethyl)piperidin-3-yl]amino]phthalazin-1-yl]benzonitrile (PubChem CID 175368263) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 3-(ethoxymethoxy)-4-[4-[[1-(2-hydroxyethyl)piperidin-3-yl]amino]phthalazin-1-yl]benzonitrile.
| Compound Name | 3-(ethoxymethoxy)-4-[4-[[1-(2-hydroxyethyl)piperidin-3-yl]amino]phthalazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 175368263 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 3-(ethoxymethoxy)-4-[4-[[1-(2-hydroxyethyl)piperidin-3-yl]amino]phthalazin-1-yl]benzonitrile |
| SMILES | CCOCOc1cc(C#N)ccc1-c1nnc(NC2CCCN(CCO)C2)c2ccccc12 |
| InChI | InChI=1S/C25H29N5O3/c1-2-32-17-33-23-14-18(15-26)9-10-22(23)24-20-7-3-4-8-21(20)25(29-28-24)27-19-6-5-11-30(16-19)12-13-31/h3-4,7-10,14,19,31H,2,5-6,11-13,16-17H2,1H3,(H,27,29) |
| InChIKey | YFTJXACSNYPTGK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|