C24H27N7O2 — CID 175599366
4-[2-(methoxymethoxy)-4-(triazol-2-yl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine (PubChem CID 175599366) has the molecular formula C24H27N7O2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 4-[2-(methoxymethoxy)-4-(triazol-2-yl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine.
| Compound Name | 4-[2-(methoxymethoxy)-4-(triazol-2-yl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine |
|---|---|
| PubChem CID | 175599366 |
| Molecular Formula | C24H27N7O2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | 4-[2-(methoxymethoxy)-4-(triazol-2-yl)phenyl]-N-(1-methylpiperidin-3-yl)phthalazin-1-amine |
| SMILES | COCOc1cc(-n2nccn2)ccc1-c1nnc(NC2CCCN(C)C2)c2ccccc12 |
| InChI | InChI=1S/C24H27N7O2/c1-30-13-5-6-17(15-30)27-24-20-8-4-3-7-19(20)23(28-29-24)21-10-9-18(31-25-11-12-26-31)14-22(21)33-16-32-2/h3-4,7-12,14,17H,5-6,13,15-16H2,1-2H3,(H,27,29) |
| InChIKey | INFWJYAQLSRBAO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|