C21H22ClN5O2 — CID 171852088
[2-amino-3-chloro-6-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]phenyl] formate (PubChem CID 171852088) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is [2-amino-3-chloro-6-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]phenyl] formate.
| Compound Name | [2-amino-3-chloro-6-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]phenyl] formate |
|---|---|
| PubChem CID | 171852088 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [2-amino-3-chloro-6-[4-[[(3R)-1-methylpiperidin-3-yl]amino]phthalazin-1-yl]phenyl] formate |
| SMILES | CN1CCC[C@@H](Nc2nnc(-c3ccc(Cl)c(N)c3OC=O)c3ccccc23)C1 |
| InChI | InChI=1S/C21H22ClN5O2/c1-27-10-4-5-13(11-27)24-21-15-7-3-2-6-14(15)19(25-26-21)16-8-9-17(22)18(23)20(16)29-12-28/h2-3,6-9,12-13H,4-5,10-11,23H2,1H3,(H,24,26)/t13-/m1/s1 |
| InChIKey | GUKXXBIJNLEPAN-CYBMUJFWSA-N |
| XLogP | 3.57 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|