C22H25FN4O — CID 169230447
N-[1-(2-fluoroethyl)piperidin-3-yl]-4-(4-methoxyphenyl)phthalazin-1-amine (PubChem CID 169230447) has the molecular formula C22H25FN4O and a molecular weight of 380.47 g/mol. Its IUPAC name is N-[1-(2-fluoroethyl)piperidin-3-yl]-4-(4-methoxyphenyl)phthalazin-1-amine.
| Compound Name | N-[1-(2-fluoroethyl)piperidin-3-yl]-4-(4-methoxyphenyl)phthalazin-1-amine |
|---|---|
| PubChem CID | 169230447 |
| Molecular Formula | C22H25FN4O |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | N-[1-(2-fluoroethyl)piperidin-3-yl]-4-(4-methoxyphenyl)phthalazin-1-amine |
| SMILES | COc1ccc(-c2nnc(NC3CCCN(CCF)C3)c3ccccc23)cc1 |
| InChI | InChI=1S/C22H25FN4O/c1-28-18-10-8-16(9-11-18)21-19-6-2-3-7-20(19)22(26-25-21)24-17-5-4-13-27(15-17)14-12-23/h2-3,6-11,17H,4-5,12-15H2,1H3,(H,24,26) |
| InChIKey | VFFXQVJTBLIDDT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |