C21H22ClN3O — CID 169230251
3-[[4-(4-chlorophenyl)phthalazin-1-yl]amino]-1-methylcyclohexan-1-ol (PubChem CID 169230251) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)phthalazin-1-yl]amino]-1-methylcyclohexan-1-ol.
| Compound Name | 3-[[4-(4-chlorophenyl)phthalazin-1-yl]amino]-1-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 169230251 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)phthalazin-1-yl]amino]-1-methylcyclohexan-1-ol |
| SMILES | CC1(O)CCCC(Nc2nnc(-c3ccc(Cl)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C21H22ClN3O/c1-21(26)12-4-5-16(13-21)23-20-18-7-3-2-6-17(18)19(24-25-20)14-8-10-15(22)11-9-14/h2-3,6-11,16,26H,4-5,12-13H2,1H3,(H,23,25) |
| InChIKey | QHPHWWODNDGOMH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |