C22H25N3 — CID 6416576
1-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)phthalazine (PubChem CID 6416576) has the molecular formula C22H25N3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)phthalazine.
| Compound Name | 1-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)phthalazine |
|---|---|
| PubChem CID | 6416576 |
| Molecular Formula | C22H25N3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-4-(3-methylpiperidin-1-yl)phthalazine |
| SMILES | Cc1ccc(-c2nnc(N3CCCC(C)C3)c3ccccc23)cc1C |
| InChI | InChI=1S/C22H25N3/c1-15-7-6-12-25(14-15)22-20-9-5-4-8-19(20)21(23-24-22)18-11-10-16(2)17(3)13-18/h4-5,8-11,13,15H,6-7,12,14H2,1-3H3 |
| InChIKey | RZRRBFWEYZNRGM-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |